C31H41NO10 — CID 66945662
(2S)-2-amino-5-benzoyloxy-3-[3,4-bis(pentoxycarbonyloxy)phenyl]hexanoic acid (PubChem CID 66945662) has the molecular formula C31H41NO10 and a molecular weight of 587.67 g/mol. Its IUPAC name is (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(pentoxycarbonyloxy)phenyl]hexanoic acid.
| Compound Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(pentoxycarbonyloxy)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 66945662 |
| Molecular Formula | C31H41NO10 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(pentoxycarbonyloxy)phenyl]hexanoic acid |
| SMILES | CCCCCOC(=O)Oc1ccc(C(CC(C)OC(=O)c2ccccc2)[C@H](N)C(=O)O)cc1OC(=O)OCCCCC |
| InChI | InChI=1S/C31H41NO10/c1-4-6-11-17-38-30(36)41-25-16-15-23(20-26(25)42-31(37)39-18-12-7-5-2)24(27(32)28(33)34)19-21(3)40-29(35)22-13-9-8-10-14-22/h8-10,13-16,20-21,24,27H,4-7,11-12,17-19,32H2,1-3H3,(H,33,34)/t21?,24?,27-/m0/s1 |
| InChIKey | OOUGFHVFWSZWHT-CGYPVTCASA-N |
| XLogP | 6.23 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|