C32H43NO10 — CID 66948641
(2S)-2-amino-5-benzoyloxy-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-4-methylhexanoic acid (PubChem CID 66948641) has the molecular formula C32H43NO10 and a molecular weight of 601.69 g/mol. Its IUPAC name is (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66948641 |
| Molecular Formula | C32H43NO10 |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-4-methylhexanoic acid |
| SMILES | CCCCCOC(=O)Oc1ccc(C(C(C)C(C)OC(=O)c2ccccc2)[C@H](N)C(=O)O)cc1OC(=O)OCCCCC |
| InChI | InChI=1S/C32H43NO10/c1-5-7-12-18-39-31(37)42-25-17-16-24(20-26(25)43-32(38)40-19-13-8-6-2)27(28(33)29(34)35)21(3)22(4)41-30(36)23-14-10-9-11-15-23/h9-11,14-17,20-22,27-28H,5-8,12-13,18-19,33H2,1-4H3,(H,34,35)/t21?,22?,27?,28-/m0/s1 |
| InChIKey | RINIUPRVEIZUBP-YIAKDLIFSA-N |
| XLogP | 6.47 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|