C28H35NO8 — CID 66950184
(2S)-2-amino-5-benzoyloxy-3-[3,4-di(butanoyloxy)phenyl]-4-methylhexanoic acid (PubChem CID 66950184) has the molecular formula C28H35NO8 and a molecular weight of 513.59 g/mol. Its IUPAC name is (2S)-2-amino-5-benzoyloxy-3-[3,4-di(butanoyloxy)phenyl]-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-di(butanoyloxy)phenyl]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66950184 |
| Molecular Formula | C28H35NO8 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-di(butanoyloxy)phenyl]-4-methylhexanoic acid |
| SMILES | CCCC(=O)Oc1ccc(C(C(C)C(C)OC(=O)c2ccccc2)[C@H](N)C(=O)O)cc1OC(=O)CCC |
| InChI | InChI=1S/C28H35NO8/c1-5-10-23(30)36-21-15-14-20(16-22(21)37-24(31)11-6-2)25(26(29)27(32)33)17(3)18(4)35-28(34)19-12-8-7-9-13-19/h7-9,12-18,25-26H,5-6,10-11,29H2,1-4H3,(H,32,33)/t17?,18?,25?,26-/m0/s1 |
| InChIKey | WLJWFBYKQYFBCZ-HOCOZBKFSA-N |
| XLogP | 4.47 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|