C31H49NO8 — CID 66947004
(2S)-2-amino-3-[3,4-di(hexanoyloxy)phenyl]-4-methyl-5-(4-methylpentanoyloxy)hexanoic acid (PubChem CID 66947004) has the molecular formula C31H49NO8 and a molecular weight of 563.73 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-di(hexanoyloxy)phenyl]-4-methyl-5-(4-methylpentanoyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-di(hexanoyloxy)phenyl]-4-methyl-5-(4-methylpentanoyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66947004 |
| Molecular Formula | C31H49NO8 |
| Molecular Weight | 563.73 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | (2S)-2-amino-3-[3,4-di(hexanoyloxy)phenyl]-4-methyl-5-(4-methylpentanoyloxy)hexanoic acid |
| SMILES | CCCCCC(=O)Oc1ccc(C(C(C)C(C)OC(=O)CCC(C)C)[C@H](N)C(=O)O)cc1OC(=O)CCCCC |
| InChI | InChI=1S/C31H49NO8/c1-7-9-11-13-26(33)39-24-17-16-23(19-25(24)40-27(34)14-12-10-8-2)29(30(32)31(36)37)21(5)22(6)38-28(35)18-15-20(3)4/h16-17,19-22,29-30H,7-15,18,32H2,1-6H3,(H,36,37)/t21?,22?,29?,30-/m0/s1 |
| InChIKey | DRZXJAHLHZSRIK-ICFOPVHVSA-N |
| XLogP | 6.16 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.73 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|