C31H49NO9 — CID 66949991
(2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylhexanoic acid (PubChem CID 66949991) has the molecular formula C31H49NO9 and a molecular weight of 579.73 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66949991 |
| Molecular Formula | C31H49NO9 |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylhexanoic acid |
| SMILES | CC(C)CCC(=O)Oc1ccc(C(C(C)C(C)OC(=O)OCC(C)(C)C)[C@H](N)C(=O)O)cc1OC(=O)CCC(C)C |
| InChI | InChI=1S/C31H49NO9/c1-18(2)10-14-25(33)40-23-13-12-22(16-24(23)41-26(34)15-11-19(3)4)27(28(32)29(35)36)20(5)21(6)39-30(37)38-17-31(7,8)9/h12-13,16,18-21,27-28H,10-11,14-15,17,32H2,1-9H3,(H,35,36)/t20?,21?,27?,28-/m0/s1 |
| InChIKey | JTOWBNDCSKHCAW-YXHBXGEOSA-N |
| XLogP | 6.09 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|