C23H33NO9 — CID 66950146
(2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-methoxycarbonyloxy-4-methylhexanoic acid (PubChem CID 66950146) has the molecular formula C23H33NO9 and a molecular weight of 467.52 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-methoxycarbonyloxy-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-methoxycarbonyloxy-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66950146 |
| Molecular Formula | C23H33NO9 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-methoxycarbonyloxy-4-methylhexanoic acid |
| SMILES | CCCC(=O)Oc1ccc(C(C(C)C(C)OC(=O)OC)[C@H](N)C(=O)O)cc1OC(=O)CCC |
| InChI | InChI=1S/C23H33NO9/c1-6-8-18(25)32-16-11-10-15(12-17(16)33-19(26)9-7-2)20(21(24)22(27)28)13(3)14(4)31-23(29)30-5/h10-14,20-21H,6-9,24H2,1-5H3,(H,27,28)/t13?,14?,20?,21-/m0/s1 |
| InChIKey | IAUTYLOFWXCOMA-CSGBRQADSA-N |
| XLogP | 3.40 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|