C22H31NO9 — CID 66947468
(2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-methoxycarbonyloxy-4-methylpentanoic acid (PubChem CID 66947468) has the molecular formula C22H31NO9 and a molecular weight of 453.49 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-methoxycarbonyloxy-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-methoxycarbonyloxy-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66947468 |
| Molecular Formula | C22H31NO9 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-methoxycarbonyloxy-4-methylpentanoic acid |
| SMILES | CCCC(=O)Oc1ccc(C(C(C)COC(=O)OC)[C@H](N)C(=O)O)cc1OC(=O)CCC |
| InChI | InChI=1S/C22H31NO9/c1-5-7-17(24)31-15-10-9-14(11-16(15)32-18(25)8-6-2)19(20(23)21(26)27)13(3)12-30-22(28)29-4/h9-11,13,19-20H,5-8,12,23H2,1-4H3,(H,26,27)/t13?,19?,20-/m0/s1 |
| InChIKey | RPOHNOXQQOEVQU-NVWHIDKOSA-N |
| XLogP | 3.01 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|