C28H43NO8 — CID 66942475
(2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-5-butanoyloxy-4-methylpentanoic acid (PubChem CID 66942475) has the molecular formula C28H43NO8 and a molecular weight of 521.65 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-5-butanoyloxy-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-5-butanoyloxy-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66942475 |
| Molecular Formula | C28H43NO8 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-5-butanoyloxy-4-methylpentanoic acid |
| SMILES | CCCC(=O)OCC(C)C(c1ccc(OC(=O)CCC(C)C)c(OC(=O)CCC(C)C)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C28H43NO8/c1-7-8-23(30)35-16-19(6)26(27(29)28(33)34)20-11-12-21(36-24(31)13-9-17(2)3)22(15-20)37-25(32)14-10-18(4)5/h11-12,15,17-19,26-27H,7-10,13-14,16,29H2,1-6H3,(H,33,34)/t19?,26?,27-/m0/s1 |
| InChIKey | CAZJFUMQMFSIQS-OEKBCGQZSA-N |
| XLogP | 4.84 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|