C30H47NO9 — CID 66944627
(2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-4-methyl-5-(2-methylbutoxycarbonyloxy)pentanoic acid (PubChem CID 66944627) has the molecular formula C30H47NO9 and a molecular weight of 565.70 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-4-methyl-5-(2-methylbutoxycarbonyloxy)pentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-4-methyl-5-(2-methylbutoxycarbonyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66944627 |
| Molecular Formula | C30H47NO9 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-4-methyl-5-(2-methylbutoxycarbonyloxy)pentanoic acid |
| SMILES | CCC(C)COC(=O)OCC(C)C(c1ccc(OC(=O)CCC(C)C)c(OC(=O)CCC(C)C)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C30H47NO9/c1-8-20(6)16-37-30(36)38-17-21(7)27(28(31)29(34)35)22-11-12-23(39-25(32)13-9-18(2)3)24(15-22)40-26(33)14-10-19(4)5/h11-12,15,18-21,27-28H,8-10,13-14,16-17,31H2,1-7H3,(H,34,35)/t20?,21?,27?,28-/m0/s1 |
| InChIKey | XZDXECTYQLQVPN-YXHBXGEOSA-N |
| XLogP | 5.70 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|