C26H39NO10 — CID 66944960
(2S)-5-acetyloxy-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]-4-methylpentanoic acid (PubChem CID 66944960) has the molecular formula C26H39NO10 and a molecular weight of 525.60 g/mol. Its IUPAC name is (2S)-5-acetyloxy-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]-4-methylpentanoic acid.
| Compound Name | (2S)-5-acetyloxy-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66944960 |
| Molecular Formula | C26H39NO10 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | (2S)-5-acetyloxy-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]-4-methylpentanoic acid |
| SMILES | CCC(C)COC(=O)Oc1ccc(C(C(C)COC(C)=O)[C@H](N)C(=O)O)cc1OC(=O)OCC(C)CC |
| InChI | InChI=1S/C26H39NO10/c1-7-15(3)12-34-25(31)36-20-10-9-19(11-21(20)37-26(32)35-13-16(4)8-2)22(23(27)24(29)30)17(5)14-33-18(6)28/h9-11,15-17,22-23H,7-8,12-14,27H2,1-6H3,(H,29,30)/t15?,16?,17?,22?,23-/m0/s1 |
| InChIKey | ZQSMILOQWZLVQF-FPJYJELGSA-N |
| XLogP | 4.50 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|