C24H35NO10 — CID 66944799
(2S)-2-amino-3-[3,4-bis(propoxycarbonyloxy)phenyl]-5-butanoyloxy-4-methylpentanoic acid (PubChem CID 66944799) has the molecular formula C24H35NO10 and a molecular weight of 497.54 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(propoxycarbonyloxy)phenyl]-5-butanoyloxy-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(propoxycarbonyloxy)phenyl]-5-butanoyloxy-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66944799 |
| Molecular Formula | C24H35NO10 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(propoxycarbonyloxy)phenyl]-5-butanoyloxy-4-methylpentanoic acid |
| SMILES | CCCOC(=O)Oc1ccc(C(C(C)COC(=O)CCC)[C@H](N)C(=O)O)cc1OC(=O)OCCC |
| InChI | InChI=1S/C24H35NO10/c1-5-8-19(26)33-14-15(4)20(21(25)22(27)28)16-9-10-17(34-23(29)31-11-6-2)18(13-16)35-24(30)32-12-7-3/h9-10,13,15,20-21H,5-8,11-12,14,25H2,1-4H3,(H,27,28)/t15?,20?,21-/m0/s1 |
| InChIKey | HGTNHKWYHTXZPT-UJWQOHNOSA-N |
| XLogP | 4.01 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|