C26H39NO9 — CID 66948262
(2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-4-methyl-5-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid (PubChem CID 66948262) has the molecular formula C26H39NO9 and a molecular weight of 509.60 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-4-methyl-5-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-4-methyl-5-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66948262 |
| Molecular Formula | C26H39NO9 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-4-methyl-5-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid |
| SMILES | CCCC(=O)Oc1ccc(C(C(C)COC(=O)OC(C)(C)CC)[C@H](N)C(=O)O)cc1OC(=O)CCC |
| InChI | InChI=1S/C26H39NO9/c1-7-10-20(28)34-18-13-12-17(14-19(18)35-21(29)11-8-2)22(23(27)24(30)31)16(4)15-33-25(32)36-26(5,6)9-3/h12-14,16,22-23H,7-11,15,27H2,1-6H3,(H,30,31)/t16?,22?,23-/m0/s1 |
| InChIKey | SKZSGAJAVWSOJL-AWYJXPRZSA-N |
| XLogP | 4.57 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|