C25H37NO8 — CID 66944723
(2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)-4-methylpentanoic acid (PubChem CID 66944723) has the molecular formula C25H37NO8 and a molecular weight of 479.57 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66944723 |
| Molecular Formula | C25H37NO8 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)-4-methylpentanoic acid |
| SMILES | CCCC(=O)Oc1ccc(C(C(C)COC(=O)C(C)(C)C)[C@H](N)C(=O)O)cc1OC(=O)CCC |
| InChI | InChI=1S/C25H37NO8/c1-7-9-19(27)33-17-12-11-16(13-18(17)34-20(28)10-8-2)21(22(26)23(29)30)15(3)14-32-24(31)25(4,5)6/h11-13,15,21-22H,7-10,14,26H2,1-6H3,(H,29,30)/t15?,21?,22-/m0/s1 |
| InChIKey | BPBSBHSPRCJHIS-KGSCVUAUSA-N |
| XLogP | 3.82 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|