C28H43NO8 — CID 66943039
(2S)-2-amino-5-butanoyloxy-3-[3,4-di(hexanoyloxy)phenyl]-4-methylpentanoic acid (PubChem CID 66943039) has the molecular formula C28H43NO8 and a molecular weight of 521.65 g/mol. Its IUPAC name is (2S)-2-amino-5-butanoyloxy-3-[3,4-di(hexanoyloxy)phenyl]-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-5-butanoyloxy-3-[3,4-di(hexanoyloxy)phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66943039 |
| Molecular Formula | C28H43NO8 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | (2S)-2-amino-5-butanoyloxy-3-[3,4-di(hexanoyloxy)phenyl]-4-methylpentanoic acid |
| SMILES | CCCCCC(=O)Oc1ccc(C(C(C)COC(=O)CCC)[C@H](N)C(=O)O)cc1OC(=O)CCCCC |
| InChI | InChI=1S/C28H43NO8/c1-5-8-10-13-24(31)36-21-16-15-20(17-22(21)37-25(32)14-11-9-6-2)26(27(29)28(33)34)19(4)18-35-23(30)12-7-3/h15-17,19,26-27H,5-14,18,29H2,1-4H3,(H,33,34)/t19?,26?,27-/m0/s1 |
| InChIKey | IRCDGOPCZVTONT-OEKBCGQZSA-N |
| XLogP | 5.13 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|