C27H41NO8 — CID 66949364
(2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-hexanoyloxy-4-methylhexanoic acid (PubChem CID 66949364) has the molecular formula C27H41NO8 and a molecular weight of 507.62 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-hexanoyloxy-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-hexanoyloxy-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66949364 |
| Molecular Formula | C27H41NO8 |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-hexanoyloxy-4-methylhexanoic acid |
| SMILES | CCCCCC(=O)OC(C)C(C)C(c1ccc(OC(=O)CCC)c(OC(=O)CCC)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C27H41NO8/c1-6-9-10-13-24(31)34-18(5)17(4)25(26(28)27(32)33)19-14-15-20(35-22(29)11-7-2)21(16-19)36-23(30)12-8-3/h14-18,25-26H,6-13,28H2,1-5H3,(H,32,33)/t17?,18?,25?,26-/m0/s1 |
| InChIKey | QDFMXNVJAHNWFT-HOCOZBKFSA-N |
| XLogP | 4.74 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|