C21H29NO10 — CID 66946447
(2S)-2-amino-3-[3,4-bis(methoxycarbonyloxy)phenyl]-4-methyl-5-(2-methylbutanoyloxy)pentanoic acid (PubChem CID 66946447) has the molecular formula C21H29NO10 and a molecular weight of 455.46 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(methoxycarbonyloxy)phenyl]-4-methyl-5-(2-methylbutanoyloxy)pentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(methoxycarbonyloxy)phenyl]-4-methyl-5-(2-methylbutanoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66946447 |
| Molecular Formula | C21H29NO10 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(methoxycarbonyloxy)phenyl]-4-methyl-5-(2-methylbutanoyloxy)pentanoic acid |
| SMILES | CCC(C)C(=O)OCC(C)C(c1ccc(OC(=O)OC)c(OC(=O)OC)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C21H29NO10/c1-6-11(2)19(25)30-10-12(3)16(17(22)18(23)24)13-7-8-14(31-20(26)28-4)15(9-13)32-21(27)29-5/h7-9,11-12,16-17H,6,10,22H2,1-5H3,(H,23,24)/t11?,12?,16?,17-/m0/s1 |
| InChIKey | LVUCCHMCCZTNHX-OUYDNOHKSA-N |
| XLogP | 2.70 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|