C28H43NO9 — CID 66946919
(2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylpentanoic acid (PubChem CID 66946919) has the molecular formula C28H43NO9 and a molecular weight of 537.65 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66946919 |
| Molecular Formula | C28H43NO9 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylpentanoic acid |
| SMILES | CCC(C)C(=O)Oc1ccc(C(C(C)COC(=O)OCC(C)(C)C)[C@H](N)C(=O)O)cc1OC(=O)C(C)CC |
| InChI | InChI=1S/C28H43NO9/c1-9-16(3)25(32)37-20-12-11-19(13-21(20)38-26(33)17(4)10-2)22(23(29)24(30)31)18(5)14-35-27(34)36-15-28(6,7)8/h11-13,16-18,22-23H,9-10,14-15,29H2,1-8H3,(H,30,31)/t16?,17?,18?,22?,23-/m0/s1 |
| InChIKey | AALWSYUKCMQALP-OGANSGBLSA-N |
| XLogP | 4.92 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|