C30H47NO9 — CID 66946638
(2S)-2-amino-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylpentanoic acid (PubChem CID 66946638) has the molecular formula C30H47NO9 and a molecular weight of 565.70 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66946638 |
| Molecular Formula | C30H47NO9 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-5-(2,2-dimethylpropoxycarbonyloxy)-4-methylpentanoic acid |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(C(C(C)COC(=O)OCC(C)(C)C)[C@H](N)C(=O)O)cc1OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C30H47NO9/c1-11-29(7,8)25(34)39-20-14-13-19(15-21(20)40-26(35)30(9,10)12-2)22(23(31)24(32)33)18(3)16-37-27(36)38-17-28(4,5)6/h13-15,18,22-23H,11-12,16-17,31H2,1-10H3,(H,32,33)/t18?,22?,23-/m0/s1 |
| InChIKey | MSYCYELLMGZAFE-CKRJSAQMSA-N |
| XLogP | 5.70 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|