C31H41NO8 — CID 66945649
(2S)-2-amino-5-benzoyloxy-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-4-methylpentanoic acid (PubChem CID 66945649) has the molecular formula C31H41NO8 and a molecular weight of 555.67 g/mol. Its IUPAC name is (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66945649 |
| Molecular Formula | C31H41NO8 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-4-methylpentanoic acid |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(C(C(C)COC(=O)c2ccccc2)[C@H](N)C(=O)O)cc1OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C31H41NO8/c1-8-30(4,5)28(36)39-22-16-15-21(17-23(22)40-29(37)31(6,7)9-2)24(25(32)26(33)34)19(3)18-38-27(35)20-13-11-10-12-14-20/h10-17,19,24-25H,8-9,18,32H2,1-7H3,(H,33,34)/t19?,24?,25-/m0/s1 |
| InChIKey | KRZXZOPZBUBUBM-GATLKJJBSA-N |
| XLogP | 5.36 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|