C29H37NO10 — CID 66943478
(2S)-2-amino-5-benzoyloxy-3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-4-methylpentanoic acid (PubChem CID 66943478) has the molecular formula C29H37NO10 and a molecular weight of 559.61 g/mol. Its IUPAC name is (2S)-2-amino-5-benzoyloxy-3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66943478 |
| Molecular Formula | C29H37NO10 |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-4-methylpentanoic acid |
| SMILES | CC(COC(=O)c1ccccc1)C(c1ccc(OC(=O)OC(C)(C)C)c(OC(=O)OC(C)(C)C)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C29H37NO10/c1-17(16-36-25(33)18-11-9-8-10-12-18)22(23(30)24(31)32)19-13-14-20(37-26(34)39-28(2,3)4)21(15-19)38-27(35)40-29(5,6)7/h8-15,17,22-23H,16,30H2,1-7H3,(H,31,32)/t17?,22?,23-/m0/s1 |
| InChIKey | WJMDXEYWDAGBBJ-KGBGCIRMSA-N |
| XLogP | 5.30 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|