C31H49NO11 — CID 66950115
(2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-4-methyl-5-pentoxycarbonyloxyhexanoic acid (PubChem CID 66950115) has the molecular formula C31H49NO11 and a molecular weight of 611.73 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-4-methyl-5-pentoxycarbonyloxyhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-4-methyl-5-pentoxycarbonyloxyhexanoic acid |
|---|---|
| PubChem CID | 66950115 |
| Molecular Formula | C31H49NO11 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-4-methyl-5-pentoxycarbonyloxyhexanoic acid |
| SMILES | CCCCCOC(=O)OC(C)C(C)C(c1ccc(OC(=O)OCCC(C)C)c(OC(=O)OCCC(C)C)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C31H49NO11/c1-8-9-10-15-38-29(35)41-22(7)21(6)26(27(32)28(33)34)23-11-12-24(42-30(36)39-16-13-19(2)3)25(18-23)43-31(37)40-17-14-20(4)5/h11-12,18-22,26-27H,8-10,13-17,32H2,1-7H3,(H,33,34)/t21?,22?,26?,27-/m0/s1 |
| InChIKey | OZOWPPLZDOWRJE-JFOWTJHLSA-N |
| XLogP | 6.67 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|