C31H49NO10 — CID 66951048
(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-5-(3,3-dimethylbutanoyloxy)-4-methylhexanoic acid (PubChem CID 66951048) has the molecular formula C31H49NO10 and a molecular weight of 595.73 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-5-(3,3-dimethylbutanoyloxy)-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-5-(3,3-dimethylbutanoyloxy)-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66951048 |
| Molecular Formula | C31H49NO10 |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-5-(3,3-dimethylbutanoyloxy)-4-methylhexanoic acid |
| SMILES | CCCCCOC(=O)Oc1ccc(C(C(C)C(C)OC(=O)CC(C)(C)C)[C@H](N)C(=O)O)cc1OC(=O)OCCCCC |
| InChI | InChI=1S/C31H49NO10/c1-8-10-12-16-38-29(36)41-23-15-14-22(18-24(23)42-30(37)39-17-13-11-9-2)26(27(32)28(34)35)20(3)21(4)40-25(33)19-31(5,6)7/h14-15,18,20-21,26-27H,8-13,16-17,19,32H2,1-7H3,(H,34,35)/t20?,21?,26?,27-/m0/s1 |
| InChIKey | QHYISGCERREQIN-DMBFXVCFSA-N |
| XLogP | 6.60 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|