C27H41NO10 — CID 66951450
(2S)-2-amino-3-[3,4-bis(butoxycarbonyloxy)phenyl]-4-methyl-5-(2-methylpropanoyloxy)hexanoic acid (PubChem CID 66951450) has the molecular formula C27H41NO10 and a molecular weight of 539.62 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(butoxycarbonyloxy)phenyl]-4-methyl-5-(2-methylpropanoyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(butoxycarbonyloxy)phenyl]-4-methyl-5-(2-methylpropanoyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66951450 |
| Molecular Formula | C27H41NO10 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(butoxycarbonyloxy)phenyl]-4-methyl-5-(2-methylpropanoyloxy)hexanoic acid |
| SMILES | CCCCOC(=O)Oc1ccc(C(C(C)C(C)OC(=O)C(C)C)[C@H](N)C(=O)O)cc1OC(=O)OCCCC |
| InChI | InChI=1S/C27H41NO10/c1-7-9-13-34-26(32)37-20-12-11-19(15-21(20)38-27(33)35-14-10-8-2)22(23(28)24(29)30)17(5)18(6)36-25(31)16(3)4/h11-12,15-18,22-23H,7-10,13-14,28H2,1-6H3,(H,29,30)/t17?,18?,22?,23-/m0/s1 |
| InChIKey | JNTXZHVPSZKUGQ-XTUZSGGNSA-N |
| XLogP | 5.04 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|