C32H43NO8 — CID 66950879
(2S)-2-amino-5-benzoyloxy-3-[3,4-bis(2-methylpentanoyloxy)phenyl]-4-methylhexanoic acid (PubChem CID 66950879) has the molecular formula C32H43NO8 and a molecular weight of 569.70 g/mol. Its IUPAC name is (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(2-methylpentanoyloxy)phenyl]-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(2-methylpentanoyloxy)phenyl]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66950879 |
| Molecular Formula | C32H43NO8 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | (2S)-2-amino-5-benzoyloxy-3-[3,4-bis(2-methylpentanoyloxy)phenyl]-4-methylhexanoic acid |
| SMILES | CCCC(C)C(=O)Oc1ccc(C(C(C)C(C)OC(=O)c2ccccc2)[C@H](N)C(=O)O)cc1OC(=O)C(C)CCC |
| InChI | InChI=1S/C32H43NO8/c1-7-12-19(3)30(36)40-25-17-16-24(18-26(25)41-31(37)20(4)13-8-2)27(28(33)29(34)35)21(5)22(6)39-32(38)23-14-10-9-11-15-23/h9-11,14-22,27-28H,7-8,12-13,33H2,1-6H3,(H,34,35)/t19?,20?,21?,22?,27?,28-/m0/s1 |
| InChIKey | XJWNFLLNLZJCSP-AIJFUPJLSA-N |
| XLogP | 5.75 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|