C30H47NO10 — CID 66951057
(2S)-2-amino-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-4-methyl-5-(2-methylbutanoyloxy)hexanoic acid (PubChem CID 66951057) has the molecular formula C30H47NO10 and a molecular weight of 581.70 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-4-methyl-5-(2-methylbutanoyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-4-methyl-5-(2-methylbutanoyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66951057 |
| Molecular Formula | C30H47NO10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-4-methyl-5-(2-methylbutanoyloxy)hexanoic acid |
| SMILES | CCCC(C)OC(=O)Oc1ccc(C(C(C)C(C)OC(=O)C(C)CC)[C@H](N)C(=O)O)cc1OC(=O)OC(C)CCC |
| InChI | InChI=1S/C30H47NO10/c1-9-12-18(5)37-29(35)40-23-15-14-22(16-24(23)41-30(36)38-19(6)13-10-2)25(26(31)27(32)33)20(7)21(8)39-28(34)17(4)11-3/h14-21,25-26H,9-13,31H2,1-8H3,(H,32,33)/t17?,18?,19?,20?,21?,25?,26-/m0/s1 |
| InChIKey | MYHXMAXTJLWFBK-NNACRWGDSA-N |
| XLogP | 6.20 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|