C25H29NO10 — CID 66945241
(2R)-2-amino-5-benzoyloxy-3-[3,4-bis(ethoxycarbonyloxy)phenyl]hexanoic acid (PubChem CID 66945241) has the molecular formula C25H29NO10 and a molecular weight of 503.50 g/mol. Its IUPAC name is (2R)-2-amino-5-benzoyloxy-3-[3,4-bis(ethoxycarbonyloxy)phenyl]hexanoic acid.
| Compound Name | (2R)-2-amino-5-benzoyloxy-3-[3,4-bis(ethoxycarbonyloxy)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 66945241 |
| Molecular Formula | C25H29NO10 |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | (2R)-2-amino-5-benzoyloxy-3-[3,4-bis(ethoxycarbonyloxy)phenyl]hexanoic acid |
| SMILES | CCOC(=O)Oc1ccc(C(CC(C)OC(=O)c2ccccc2)[C@@H](N)C(=O)O)cc1OC(=O)OCC |
| InChI | InChI=1S/C25H29NO10/c1-4-32-24(30)35-19-12-11-17(14-20(19)36-25(31)33-5-2)18(21(26)22(27)28)13-15(3)34-23(29)16-9-7-6-8-10-16/h6-12,14-15,18,21H,4-5,13,26H2,1-3H3,(H,27,28)/t15?,18?,21-/m1/s1 |
| InChIKey | LUPIYVQWHLSZFL-ZYKWQNGHSA-N |
| XLogP | 3.89 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|