C30H47NO10 — CID 66943908
(2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-5-hexanoyloxyhexanoic acid (PubChem CID 66943908) has the molecular formula C30H47NO10 and a molecular weight of 581.70 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-5-hexanoyloxyhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-5-hexanoyloxyhexanoic acid |
|---|---|
| PubChem CID | 66943908 |
| Molecular Formula | C30H47NO10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-5-hexanoyloxyhexanoic acid |
| SMILES | CCCCCC(=O)OC(C)CC(c1ccc(OC(=O)OCC(C)(C)C)c(OC(=O)OCC(C)(C)C)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C30H47NO10/c1-9-10-11-12-24(32)39-19(2)15-21(25(31)26(33)34)20-13-14-22(40-27(35)37-17-29(3,4)5)23(16-20)41-28(36)38-18-30(6,7)8/h13-14,16,19,21,25H,9-12,15,17-18,31H2,1-8H3,(H,33,34)/t19?,21?,25-/m0/s1 |
| InChIKey | GXCKXBMIRZMJBJ-AJPKXHFHSA-N |
| XLogP | 6.21 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|