C24H35NO8 — CID 66947956
(2S)-2-amino-5-(2,3-dimethylbutanoyloxy)-3-[3,4-di(propanoyloxy)phenyl]hexanoic acid (PubChem CID 66947956) has the molecular formula C24H35NO8 and a molecular weight of 465.54 g/mol. Its IUPAC name is (2S)-2-amino-5-(2,3-dimethylbutanoyloxy)-3-[3,4-di(propanoyloxy)phenyl]hexanoic acid.
| Compound Name | (2S)-2-amino-5-(2,3-dimethylbutanoyloxy)-3-[3,4-di(propanoyloxy)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 66947956 |
| Molecular Formula | C24H35NO8 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (2S)-2-amino-5-(2,3-dimethylbutanoyloxy)-3-[3,4-di(propanoyloxy)phenyl]hexanoic acid |
| SMILES | CCC(=O)Oc1ccc(C(CC(C)OC(=O)C(C)C(C)C)[C@H](N)C(=O)O)cc1OC(=O)CC |
| InChI | InChI=1S/C24H35NO8/c1-7-20(26)32-18-10-9-16(12-19(18)33-21(27)8-2)17(22(25)23(28)29)11-14(5)31-24(30)15(6)13(3)4/h9-10,12-15,17,22H,7-8,11,25H2,1-6H3,(H,28,29)/t14?,15?,17?,22-/m0/s1 |
| InChIKey | KQXGYISPMUQXFY-OYNJSTQKSA-N |
| XLogP | 3.43 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|