C30H47NO11 — CID 66945342
(2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-5-(3-methylbutan-2-yloxycarbonyloxy)hexanoic acid (PubChem CID 66945342) has the molecular formula C30H47NO11 and a molecular weight of 597.70 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-5-(3-methylbutan-2-yloxycarbonyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-5-(3-methylbutan-2-yloxycarbonyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66945342 |
| Molecular Formula | C30H47NO11 |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-5-(3-methylbutan-2-yloxycarbonyloxy)hexanoic acid |
| SMILES | CC(CC(c1ccc(OC(=O)OC(C)C(C)C)c(OC(=O)OC(C)C(C)C)c1)[C@H](N)C(=O)O)OC(=O)OC(C)C(C)C |
| InChI | InChI=1S/C30H47NO11/c1-15(2)19(8)38-28(34)37-18(7)13-23(26(31)27(32)33)22-11-12-24(41-29(35)39-20(9)16(3)4)25(14-22)42-30(36)40-21(10)17(5)6/h11-12,14-21,23,26H,13,31H2,1-10H3,(H,32,33)/t18?,19?,20?,21?,23?,26-/m0/s1 |
| InChIKey | IEUAPZVQCGOECS-IJYFKUDUSA-N |
| XLogP | 6.28 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|