C27H41NO11 — CID 66947926
(2S)-2-amino-3-[3,4-bis(butan-2-yloxycarbonyloxy)phenyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]hexanoic acid (PubChem CID 66947926) has the molecular formula C27H41NO11 and a molecular weight of 555.62 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(butan-2-yloxycarbonyloxy)phenyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(butan-2-yloxycarbonyloxy)phenyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]hexanoic acid |
|---|---|
| PubChem CID | 66947926 |
| Molecular Formula | C27H41NO11 |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(butan-2-yloxycarbonyloxy)phenyl]-5-[(2-methylpropan-2-yl)oxycarbonyloxy]hexanoic acid |
| SMILES | CCC(C)OC(=O)Oc1ccc(C(CC(C)OC(=O)OC(C)(C)C)[C@H](N)C(=O)O)cc1OC(=O)OC(C)CC |
| InChI | InChI=1S/C27H41NO11/c1-9-15(3)34-24(31)37-20-12-11-18(14-21(20)38-25(32)35-16(4)10-2)19(22(28)23(29)30)13-17(5)36-26(33)39-27(6,7)8/h11-12,14-17,19,22H,9-10,13,28H2,1-8H3,(H,29,30)/t15?,16?,17?,19?,22-/m0/s1 |
| InChIKey | DKKHGEQTLDTTAM-APGULLGXSA-N |
| XLogP | 5.54 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|