C14H21NO3 — CID 171250068
[4-[(1R)-1-amino-2,2-dimethylpropyl]-2-methoxyphenyl] acetate (PubChem CID 171250068) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is [4-[(1R)-1-amino-2,2-dimethylpropyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(1R)-1-amino-2,2-dimethylpropyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 171250068 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | [4-[(1R)-1-amino-2,2-dimethylpropyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc([C@H](N)C(C)(C)C)ccc1OC(C)=O |
| InChI | InChI=1S/C14H21NO3/c1-9(16)18-11-7-6-10(8-12(11)17-5)13(15)14(2,3)4/h6-8,13H,15H2,1-5H3/t13-/m0/s1 |
| InChIKey | QJEXSJSRGJMMAJ-ZDUSSCGKSA-N |
| XLogP | 2.67 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|