C14H22ClNO4 — CID 171250065
[4-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-2-methoxyphenyl] acetate;hydrochloride (PubChem CID 171250065) has the molecular formula C14H22ClNO4 and a molecular weight of 303.79 g/mol. Its IUPAC name is [4-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-2-methoxyphenyl] acetate;hydrochloride.
| Compound Name | [4-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-2-methoxyphenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171250065 |
| Molecular Formula | C14H22ClNO4 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [4-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-2-methoxyphenyl] acetate;hydrochloride |
| SMILES | COc1cc([C@H](N)C(C)(C)CO)ccc1OC(C)=O.Cl |
| InChI | InChI=1S/C14H21NO4.ClH/c1-9(17)19-11-6-5-10(7-12(11)18-4)13(15)14(2,3)8-16;/h5-7,13,16H,8,15H2,1-4H3;1H/t13-;/m0./s1 |
| InChIKey | YDBYCQMUPJADLG-ZOWNYOTGSA-N |
| XLogP | 2.06 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|