C18H29ClN2O4 — CID 171190166
[4-[(1S)-3-hydroxy-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate;hydrochloride (PubChem CID 171190166) has the molecular formula C18H29ClN2O4 and a molecular weight of 372.89 g/mol. Its IUPAC name is [4-[(1S)-3-hydroxy-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate;hydrochloride.
| Compound Name | [4-[(1S)-3-hydroxy-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171190166 |
| Molecular Formula | C18H29ClN2O4 |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [4-[(1S)-3-hydroxy-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-methoxyphenyl] acetate;hydrochloride |
| SMILES | COc1cc([C@H](N2CCNCC2)C(C)(C)CO)ccc1OC(C)=O.Cl |
| InChI | InChI=1S/C18H28N2O4.ClH/c1-13(22)24-15-6-5-14(11-16(15)23-4)17(18(2,3)12-21)20-9-7-19-8-10-20;/h5-6,11,17,19,21H,7-10,12H2,1-4H3;1H/t17-;/m0./s1 |
| InChIKey | AYQGEGYTTDJDFW-LMOVPXPDSA-N |
| XLogP | 2.01 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|