C15H22N2O4 — CID 171183530
[4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-2-methoxyphenyl] acetate (PubChem CID 171183530) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is [4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 171183530 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [4-[(1R)-2-hydroxy-1-piperazin-1-ylethyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc([C@H](CO)N2CCNCC2)ccc1OC(C)=O |
| InChI | InChI=1S/C15H22N2O4/c1-11(19)21-14-4-3-12(9-15(14)20-2)13(10-18)17-7-5-16-6-8-17/h3-4,9,13,16,18H,5-8,10H2,1-2H3/t13-/m0/s1 |
| InChIKey | XMAZEVQWFWSJIU-ZDUSSCGKSA-N |
| XLogP | 0.56 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|