C14H23ClN2O3 — CID 171183326
(2R)-2-(3,4-dimethoxyphenyl)-2-piperazin-1-ylethanol;hydrochloride (PubChem CID 171183326) has the molecular formula C14H23ClN2O3 and a molecular weight of 302.80 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethoxyphenyl)-2-piperazin-1-ylethanol;hydrochloride.
| Compound Name | (2R)-2-(3,4-dimethoxyphenyl)-2-piperazin-1-ylethanol;hydrochloride |
|---|---|
| PubChem CID | 171183326 |
| Molecular Formula | C14H23ClN2O3 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (2R)-2-(3,4-dimethoxyphenyl)-2-piperazin-1-ylethanol;hydrochloride |
| SMILES | COc1ccc([C@H](CO)N2CCNCC2)cc1OC.Cl |
| InChI | InChI=1S/C14H22N2O3.ClH/c1-18-13-4-3-11(9-14(13)19-2)12(10-17)16-7-5-15-6-8-16;/h3-4,9,12,15,17H,5-8,10H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | BGATZCHQRXGTFE-YDALLXLXSA-N |
| XLogP | 1.06 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |