C19H31N3O2 — CID 83978283
1-[1-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]piperazine (PubChem CID 83978283) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]piperazine.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]piperazine |
|---|---|
| PubChem CID | 83978283 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)-2-piperidin-1-ylethyl]piperazine |
| SMILES | COc1ccc(C(CN2CCCCC2)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C19H31N3O2/c1-23-18-7-6-16(14-19(18)24-2)17(22-12-8-20-9-13-22)15-21-10-4-3-5-11-21/h6-7,14,17,20H,3-5,8-13,15H2,1-2H3 |
| InChIKey | PPRXBVRRTQCCFG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |