C14H22N2O2 — CID 28798624
1-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]piperazine (PubChem CID 28798624) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]piperazine.
| Compound Name | 1-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 28798624 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]piperazine |
| SMILES | COc1ccc([C@@H](C)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C14H22N2O2/c1-11(16-8-6-15-7-9-16)12-4-5-13(17-2)14(10-12)18-3/h4-5,10-11,15H,6-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | LLIXNMSGKYIHJY-LLVKDONJSA-N |
| XLogP | 1.67 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |