C19H32N4O2 — CID 112539500
1-[2-(3,4-dimethoxyphenyl)-2-piperazin-1-ylethyl]-4-methylpiperazine (PubChem CID 112539500) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)-2-piperazin-1-ylethyl]-4-methylpiperazine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)-2-piperazin-1-ylethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 112539500 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)-2-piperazin-1-ylethyl]-4-methylpiperazine |
| SMILES | COc1ccc(C(CN2CCN(C)CC2)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C19H32N4O2/c1-21-10-12-22(13-11-21)15-17(23-8-6-20-7-9-23)16-4-5-18(24-2)19(14-16)25-3/h4-5,14,17,20H,6-13,15H2,1-3H3 |
| InChIKey | PORWBFWOQYCIPY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 40.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |