C16H26N2O2 — CID 9161144
(2R)-2-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 9161144) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (2R)-2-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | (2R)-2-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 9161144 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (2R)-2-(azepan-1-yl)-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc([C@H](CN)N2CCCCCC2)cc1OC |
| InChI | InChI=1S/C16H26N2O2/c1-19-15-8-7-13(11-16(15)20-2)14(12-17)18-9-5-3-4-6-10-18/h7-8,11,14H,3-6,9-10,12,17H2,1-2H3/t14-/m0/s1 |
| InChIKey | ORMKZJKPZHAGHI-AWEZNQCLSA-N |
| XLogP | 2.58 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |