C18H31N3O2 — CID 83979728
2-[3-methoxy-4-(2-methylpropoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 83979728) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-[3-methoxy-4-(2-methylpropoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanamine.
| Compound Name | 2-[3-methoxy-4-(2-methylpropoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 83979728 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 2-[3-methoxy-4-(2-methylpropoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | COc1cc(C(CN)N2CCN(C)CC2)ccc1OCC(C)C |
| InChI | InChI=1S/C18H31N3O2/c1-14(2)13-23-17-6-5-15(11-18(17)22-4)16(12-19)21-9-7-20(3)8-10-21/h5-6,11,14,16H,7-10,12-13,19H2,1-4H3 |
| InChIKey | RNPKSFGMWWVRTP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |