C20H31N3O2 — CID 112540269
2-(2-ethyl-4-methylpiperazin-1-yl)-2-[3-methoxy-4-(2-methylpropoxy)phenyl]acetonitrile (PubChem CID 112540269) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-(2-ethyl-4-methylpiperazin-1-yl)-2-[3-methoxy-4-(2-methylpropoxy)phenyl]acetonitrile.
| Compound Name | 2-(2-ethyl-4-methylpiperazin-1-yl)-2-[3-methoxy-4-(2-methylpropoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 112540269 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 2-(2-ethyl-4-methylpiperazin-1-yl)-2-[3-methoxy-4-(2-methylpropoxy)phenyl]acetonitrile |
| SMILES | CCC1CN(C)CCN1C(C#N)c1ccc(OCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C20H31N3O2/c1-6-17-13-22(4)9-10-23(17)18(12-21)16-7-8-19(20(11-16)24-5)25-14-15(2)3/h7-8,11,15,17-18H,6,9-10,13-14H2,1-5H3 |
| InChIKey | SFYDEQHXSWNQDS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |