C15H20BrN3O — CID 112540218
2-(3-bromo-4-hydroxyphenyl)-2-(2-ethyl-4-methylpiperazin-1-yl)acetonitrile (PubChem CID 112540218) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is 2-(3-bromo-4-hydroxyphenyl)-2-(2-ethyl-4-methylpiperazin-1-yl)acetonitrile.
| Compound Name | 2-(3-bromo-4-hydroxyphenyl)-2-(2-ethyl-4-methylpiperazin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 112540218 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-(3-bromo-4-hydroxyphenyl)-2-(2-ethyl-4-methylpiperazin-1-yl)acetonitrile |
| SMILES | CCC1CN(C)CCN1C(C#N)c1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C15H20BrN3O/c1-3-12-10-18(2)6-7-19(12)14(9-17)11-4-5-15(20)13(16)8-11/h4-5,8,12,14,20H,3,6-7,10H2,1-2H3 |
| InChIKey | JEDMBZSOLKABCK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |