C19H33N3O2 — CID 83979259
2-(3,4-diethylpiperazin-1-yl)-2-(4-ethoxy-3-methoxyphenyl)ethanamine (PubChem CID 83979259) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 2-(3,4-diethylpiperazin-1-yl)-2-(4-ethoxy-3-methoxyphenyl)ethanamine.
| Compound Name | 2-(3,4-diethylpiperazin-1-yl)-2-(4-ethoxy-3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 83979259 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 2-(3,4-diethylpiperazin-1-yl)-2-(4-ethoxy-3-methoxyphenyl)ethanamine |
| SMILES | CCOc1ccc(C(CN)N2CCN(CC)C(CC)C2)cc1OC |
| InChI | InChI=1S/C19H33N3O2/c1-5-16-14-22(11-10-21(16)6-2)17(13-20)15-8-9-18(24-7-3)19(12-15)23-4/h8-9,12,16-17H,5-7,10-11,13-14,20H2,1-4H3 |
| InChIKey | ZXVBPNHFKDQKNM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |