C16H26N2O3 — CID 83979284
2-(4-ethoxy-3-methoxyphenyl)-2-(3-methylpiperazin-1-yl)ethanol (PubChem CID 83979284) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(4-ethoxy-3-methoxyphenyl)-2-(3-methylpiperazin-1-yl)ethanol.
| Compound Name | 2-(4-ethoxy-3-methoxyphenyl)-2-(3-methylpiperazin-1-yl)ethanol |
|---|---|
| PubChem CID | 83979284 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-(4-ethoxy-3-methoxyphenyl)-2-(3-methylpiperazin-1-yl)ethanol |
| SMILES | CCOc1ccc(C(CO)N2CCNC(C)C2)cc1OC |
| InChI | InChI=1S/C16H26N2O3/c1-4-21-15-6-5-13(9-16(15)20-3)14(11-19)18-8-7-17-12(2)10-18/h5-6,9,12,14,17,19H,4,7-8,10-11H2,1-3H3 |
| InChIKey | STDSKNALSPQPFS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |