C19H31N3O3 — CID 112539497
4-[2-(3,4-dimethoxyphenyl)-2-(3-methylpiperazin-1-yl)ethyl]morpholine (PubChem CID 112539497) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)-2-(3-methylpiperazin-1-yl)ethyl]morpholine.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)-2-(3-methylpiperazin-1-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 112539497 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)-2-(3-methylpiperazin-1-yl)ethyl]morpholine |
| SMILES | COc1ccc(C(CN2CCOCC2)N2CCNC(C)C2)cc1OC |
| InChI | InChI=1S/C19H31N3O3/c1-15-13-22(7-6-20-15)17(14-21-8-10-25-11-9-21)16-4-5-18(23-2)19(12-16)24-3/h4-5,12,15,17,20H,6-11,13-14H2,1-3H3 |
| InChIKey | QSJWDVHAIYXAEG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |