C19H30ClN3 — CID 83977826
1-[1-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)ethyl]-3-methylpiperazine (PubChem CID 83977826) has the molecular formula C19H30ClN3 and a molecular weight of 335.92 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)ethyl]-3-methylpiperazine.
| Compound Name | 1-[1-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)ethyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 83977826 |
| Molecular Formula | C19H30ClN3 |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 1-[1-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)ethyl]-3-methylpiperazine |
| SMILES | CC1CCN(CC(c2cccc(Cl)c2)N2CCNC(C)C2)CC1 |
| InChI | InChI=1S/C19H30ClN3/c1-15-6-9-22(10-7-15)14-19(17-4-3-5-18(20)12-17)23-11-8-21-16(2)13-23/h3-5,12,15-16,19,21H,6-11,13-14H2,1-2H3 |
| InChIKey | QGFDDNIOQCHUJQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |