C18H28FN3O — CID 83978195
1-[2-(4-fluorophenyl)-2-(3-methylpiperazin-1-yl)ethyl]piperidin-4-ol (PubChem CID 83978195) has the molecular formula C18H28FN3O and a molecular weight of 321.44 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-(3-methylpiperazin-1-yl)ethyl]piperidin-4-ol.
| Compound Name | 1-[2-(4-fluorophenyl)-2-(3-methylpiperazin-1-yl)ethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 83978195 |
| Molecular Formula | C18H28FN3O |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-(3-methylpiperazin-1-yl)ethyl]piperidin-4-ol |
| SMILES | CC1CN(C(CN2CCC(O)CC2)c2ccc(F)cc2)CCN1 |
| InChI | InChI=1S/C18H28FN3O/c1-14-12-22(11-8-20-14)18(15-2-4-16(19)5-3-15)13-21-9-6-17(23)7-10-21/h2-5,14,17-18,20,23H,6-13H2,1H3 |
| InChIKey | HHXQOADCIVMJLF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |