C18H29FN4 — CID 83978178
1-[1-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-3-methylpiperazine (PubChem CID 83978178) has the molecular formula C18H29FN4 and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-3-methylpiperazine.
| Compound Name | 1-[1-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 83978178 |
| Molecular Formula | C18H29FN4 |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-3-methylpiperazine |
| SMILES | CC1CN(C(CN2CCN(C)CC2)c2ccc(F)cc2)CCN1 |
| InChI | InChI=1S/C18H29FN4/c1-15-13-23(8-7-20-15)18(16-3-5-17(19)6-4-16)14-22-11-9-21(2)10-12-22/h3-6,15,18,20H,7-14H2,1-2H3 |
| InChIKey | RVUXRODWXOUGCI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |