C20H34N4 — CID 83978531
1-[1-(4-ethylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-3-methylpiperazine (PubChem CID 83978531) has the molecular formula C20H34N4 and a molecular weight of 330.52 g/mol. Its IUPAC name is 1-[1-(4-ethylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-3-methylpiperazine.
| Compound Name | 1-[1-(4-ethylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 83978531 |
| Molecular Formula | C20H34N4 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | 1-[1-(4-ethylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-3-methylpiperazine |
| SMILES | CCc1ccc(C(CN2CCN(C)CC2)N2CCNC(C)C2)cc1 |
| InChI | InChI=1S/C20H34N4/c1-4-18-5-7-19(8-6-18)20(24-10-9-21-17(2)15-24)16-23-13-11-22(3)12-14-23/h5-8,17,20-21H,4,9-16H2,1-3H3 |
| InChIKey | ALHSDOXMDICPDJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |