C16H27N3OS — CID 83979406
1-[2-(3-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]piperidin-4-ol (PubChem CID 83979406) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is 1-[2-(3-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]piperidin-4-ol.
| Compound Name | 1-[2-(3-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 83979406 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-[2-(3-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]piperidin-4-ol |
| SMILES | CC1CN(C(CN2CCC(O)CC2)c2cccs2)CCN1 |
| InChI | InChI=1S/C16H27N3OS/c1-13-11-19(9-6-17-13)15(16-3-2-10-21-16)12-18-7-4-14(20)5-8-18/h2-3,10,13-15,17,20H,4-9,11-12H2,1H3 |
| InChIKey | LZQSPLIYVAMIFS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |